Difference between revisions of "PWY-6027"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] ==
+== Pathway PWY-6027 ==
+* taxonomic-range:
+** tax-4071
 * common-name:
-** red chlorophyll catabolite
+** capsiconiate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
+* [[RXN-1106]]
-* inchi-key:
+== Reaction(s) not found ==
-** gvtpycxgtfqzdt-yssugppcsa-m
+* [NoneRXN-9719 RXN-9719]
-* molecular-weight:
+* [NoneRXN-8926 RXN-8926]
-** 624.692
+* [NoneRXN-2602 RXN-2602]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-4071}}
-* [[RXN-7741]]
+{{#set: common-name=capsiconiate biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-7740]]
+{{#set: completion rate=0.25}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=red chlorophyll catabolite}}
-{{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}}
-{{#set: molecular-weight=624.692}}