Difference between revisions of "PWY-6027"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == * common-name: ** red chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLT-tRNAs GLT-tRNAs] == * common-name: ** a trnaglu == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLT-tRNAs GLT-tRNAs] ==
 
* common-name:
 
* common-name:
** red chlorophyll catabolite
+
** a trnaglu
* smiles:
 
** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
 
* inchi-key:
 
** gvtpycxgtfqzdt-yssugppcsa-m
 
* molecular-weight:
 
** 624.692
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7741]]
+
* [[GLURS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7740]]
+
* [[GLUTRNAREDUCT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=red chlorophyll catabolite}}
+
{{#set: common-name=a trnaglu}}
{{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}}
 
{{#set: molecular-weight=624.692}}
 

Revision as of 09:22, 27 August 2019

Metabolite GLT-tRNAs

  • common-name:
    • a trnaglu

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality