Difference between revisions of "PWY-6073"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * common-name: ** dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12118 CPD-12118] == * common-name: ** demethylmenaquinol-9 * smiles: ** cc(=cccc(c)=cccc(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12118 CPD-12118] ==
 
* common-name:
 
* common-name:
** dgmp
+
** demethylmenaquinol-9
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
 
* inchi-key:
 
* inchi-key:
** ltfmzdnnppeqng-kvqbguixsa-l
+
** wjuvwmhfghnqjz-rnfptggasa-n
 
* molecular-weight:
 
* molecular-weight:
** 345.208
+
** 773.236
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDGM]]
+
* [[RXN-9205]]
* [[DMPH]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DGTD]]
 
* [[DMPH]]
 
* [[RXN-14208]]
 
* [[RXN-14218]]
 
* [[RXN0-385]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dgmp}}
+
{{#set: common-name=demethylmenaquinol-9}}
{{#set: inchi-key=inchikey=ltfmzdnnppeqng-kvqbguixsa-l}}
+
{{#set: inchi-key=inchikey=wjuvwmhfghnqjz-rnfptggasa-n}}
{{#set: molecular-weight=345.208}}
+
{{#set: molecular-weight=773.236}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-12118

  • common-name:
    • demethylmenaquinol-9
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
  • inchi-key:
    • wjuvwmhfghnqjz-rnfptggasa-n
  • molecular-weight:
    • 773.236

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality