Difference between revisions of "PWY-6089"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * common-name: ** scyllo-inosose * smiles: ** c1(c(c(c(c(c1o)o)=o)o)o)o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-177 CPD-177] == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 3-phosphate == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-177 CPD-177] ==
 
* common-name:
 
* common-name:
** scyllo-inosose
+
** a 1-phosphatidyl-1d-myo-inositol 3-phosphate
* smiles:
 
** c1(c(c(c(c(c1o)o)=o)o)o)o
 
* inchi-key:
 
** vyegbdhsghxogt-hyfglkjpsa-n
 
* molecular-weight:
 
** 178.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
* [[2.7.1.150-RXN]]
* [[RXN-13779]]
+
* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
* [[RXN-13779]]
+
* [[3.1.3.66-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=scyllo-inosose}}
+
{{#set: common-name=a 1-phosphatidyl-1d-myo-inositol 3-phosphate}}
{{#set: inchi-key=inchikey=vyegbdhsghxogt-hyfglkjpsa-n}}
 
{{#set: molecular-weight=178.141}}
 

Revision as of 09:22, 27 August 2019

Metabolite CPD-177

  • common-name:
    • a 1-phosphatidyl-1d-myo-inositol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality