Difference between revisions of "PWY-6100"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14795 CPD-14795] ==
+== Pathway PWY-6100 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** udp-n-acetyl-&alpha;-d-galactosamine
+** l-carnitine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
+* [[1.14.11.1-RXN]]
-* inchi-key:
+* [[RXN-9896]]
-** lftytuazoprmmi-nessujcysa-l
+* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 605.342
+* [None1.2.1.47-RXN 1.2.1.47-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2759}}
-* [[RXN-13760]]
+{{#set: common-name=l-carnitine biosynthesis}}
-* [[RXN-14841]]
+{{#set: nb reaction found=3}}
-* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
+{{#set: completion rate=0.75}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=4}}
-* [[RXN-13760]]
-* [[RXN-14841]]
-* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=udp-n-acetyl-&alpha;-d-galactosamine}}
-{{#set: inchi-key=inchikey=lftytuazoprmmi-nessujcysa-l}}
-{{#set: molecular-weight=605.342}}