Difference between revisions of "PWY-6100"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-43 CPD66-43] == * common-name: ** 2-palmitoylglycerol * smiles: ** cccccccccccccccc(=o)oc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14795 CPD-14795] == * common-name: ** udp-n-acetyl-α-d-galactosamine * smiles: ** cc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-43 CPD66-43] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14795 CPD-14795] ==
 
* common-name:
 
* common-name:
** 2-palmitoylglycerol
+
** udp-n-acetyl-α-d-galactosamine
 
* smiles:
 
* smiles:
** cccccccccccccccc(=o)oc(co)co
+
** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
 
* inchi-key:
 
* inchi-key:
** bbnyclarevxosg-uhfffaoysa-n
+
** lftytuazoprmmi-nessujcysa-l
 
* molecular-weight:
 
* molecular-weight:
** 330.507
+
** 605.342
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
+
* [[RXN-13760]]
* [[RXN-7952-CPD66-43/WATER//GLYCEROL/PALMITATE/PROTON.42.]]
+
* [[RXN-14841]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
+
* [[RXN-13760]]
* [[RXN-1602-CPD-17271/WATER//CPD66-43/STEARIC_ACID/PROTON.46.]]
+
* [[RXN-14841]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-palmitoylglycerol}}
+
{{#set: common-name=udp-n-acetyl-α-d-galactosamine}}
{{#set: inchi-key=inchikey=bbnyclarevxosg-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=lftytuazoprmmi-nessujcysa-l}}
{{#set: molecular-weight=330.507}}
+
{{#set: molecular-weight=605.342}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-14795

  • common-name:
    • udp-n-acetyl-α-d-galactosamine
  • smiles:
    • cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
  • inchi-key:
    • lftytuazoprmmi-nessujcysa-l
  • molecular-weight:
    • 605.342

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality