Difference between revisions of "PWY-6107"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11937 CPD-11937] ==
+== Pathway PWY-6107 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
+** chlorosalicylate degradation
-* smiles:
+== Reaction(s) found ==
-** c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
+* [[RXN-9912]]
-* inchi-key:
+* [[RXN-9914]]
-** uphpwxpnziozjl-ptqmnwpwsa-b
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-9869 RXN-9869]
-** 727.921
+* [NoneRXN-9913 RXN-9913]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-9870 RXN-9870]
-* [[RXN-10973]]
+* [NoneMALEYLACETATE-REDUCTASE-RXN MALEYLACETATE-REDUCTASE-RXN]
-* [[RXN-10976]]
+* [NoneRXN-9892 RXN-9892]
-* [[RXN-10978]]
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=chlorosalicylate degradation}}
-* [[RXN-10971]]
+{{#set: nb reaction found=2}}
-* [[RXN-10976]]
+{{#set: completion rate=0.29}}
-* [[RXN-10978]]
+{{#set: nb total reaction=7}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}}
-{{#set: inchi-key=inchikey=uphpwxpnziozjl-ptqmnwpwsa-b}}
-{{#set: molecular-weight=727.921}}