Difference between revisions of "PWY-6107"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11937 CPD-11937] == * common-name: ** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosp...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALATE OXALATE] == * common-name: ** oxalate * smiles: ** c([o-])(c(=o)[o-])=o * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11937 CPD-11937] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALATE OXALATE] ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
+
** oxalate
 
* smiles:
 
* smiles:
** c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
+
** c([o-])(c(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** uphpwxpnziozjl-ptqmnwpwsa-b
+
** mubzpkhoepujkr-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 727.921
+
** 88.02
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10973]]
+
* [[OXALATE-DECARBOXYLASE-RXN]]
* [[RXN-10976]]
 
* [[RXN-10978]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10971]]
+
* [[GLYOXYLATE-OXIDASE-RXN]]
* [[RXN-10976]]
 
* [[RXN-10978]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}}
+
{{#set: common-name=oxalate}}
{{#set: inchi-key=inchikey=uphpwxpnziozjl-ptqmnwpwsa-b}}
+
{{#set: inchi-key=inchikey=mubzpkhoepujkr-uhfffaoysa-l}}
{{#set: molecular-weight=727.921}}
+
{{#set: molecular-weight=88.02}}

Revision as of 09:22, 27 August 2019

Metabolite OXALATE

  • common-name:
    • oxalate
  • smiles:
    • c([o-])(c(=o)[o-])=o
  • inchi-key:
    • mubzpkhoepujkr-uhfffaoysa-l
  • molecular-weight:
    • 88.02

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality