Difference between revisions of "PWY-6111"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-L-RHAMNOSE UDP-L-RHAMNOSE] ==
+== Pathway PWY-6111 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** udp-&beta;-l-rhamnose
+** mitochondrial l-carnitine shuttle
-* smiles:
+== Reaction(s) found ==
-** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
+* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
-* inchi-key:
+* [[RXN-9918]]
-** drdcjeizvlvwnc-slbwpepysa-l
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneTRANS-RXN-177 TRANS-RXN-177]
-** 548.29
+{{#set: taxonomic-range=tax-2759}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=mitochondrial l-carnitine shuttle}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-10740]]
+{{#set: completion rate=0.67}}
-* [[RXN-5482]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=udp-&beta;-l-rhamnose}}
-{{#set: inchi-key=inchikey=drdcjeizvlvwnc-slbwpepysa-l}}
-{{#set: molecular-weight=548.29}}