Difference between revisions of "PWY-6111"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOYL-AMP LIPOYL-AMP] ==
+== Pathway PWY-6111 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** lipoyl-adenylate
+** mitochondrial l-carnitine shuttle
-* smiles:
+== Reaction(s) found ==
-** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=o)
+* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
-* inchi-key:
+* [[RXN-9918]]
-** qwegocjrzoksoe-aduakinbsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-21778 RXN-21778]
-** 534.518
+* [NoneTRANS-RXN-177 TRANS-RXN-177]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2759}}
-* [[RXN-13039]]
+{{#set: common-name=mitochondrial l-carnitine shuttle}}
-* [[RXN-8655]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-* [[RXN-8654]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=lipoyl-adenylate}}
-{{#set: inchi-key=inchikey=qwegocjrzoksoe-aduakinbsa-m}}
-{{#set: molecular-weight=534.518}}