Difference between revisions of "PWY-6113"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * common-name: ** creatine * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13293 CPD-13293] == * common-name: ** β-d-fucose * smiles: ** cc1(c(o)c(o)c(o)c(o)o1)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13293 CPD-13293] == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-fucose |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c(o)c(o)c(o)c(o)o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** shzgcjcmobcmkk-fprjbgldsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 164.158 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.38-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-fucose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=shzgcjcmobcmkk-fprjbgldsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=164.158}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-13293
- common-name:
- β-d-fucose
- smiles:
- cc1(c(o)c(o)c(o)c(o)o1)
- inchi-key:
- shzgcjcmobcmkk-fprjbgldsa-n
- molecular-weight:
- 164.158
