Difference between revisions of "PWY-6120"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == * common-name: ** d-gluconate 6-phosphate * smiles: ** c(c(c(c(c(c([o-])=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfhydryls Sulfhydryls] == * common-name: ** r'c(r)sh == Reaction(s) known to consume the comp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfhydryls Sulfhydryls] ==
 
* common-name:
 
* common-name:
** d-gluconate 6-phosphate
+
** r'c(r)sh
* smiles:
 
** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o
 
* inchi-key:
 
** birsgzkfkxlsjq-sqougzdysa-k
 
* molecular-weight:
 
** 273.113
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[6PGLUCONDEHYDROG-RXN]]
+
* [[THIOL-OXIDASE-RXN]]
* [[PGLUCONDEHYDRAT-RXN]]
 
* [[RXN-3341]]
 
* [[RXN-9952]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6PGLUCONOLACT-RXN]]
 
* [[GLUCONOKIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-gluconate 6-phosphate}}
+
{{#set: common-name=r'c(r)sh}}
{{#set: inchi-key=inchikey=birsgzkfkxlsjq-sqougzdysa-k}}
 
{{#set: molecular-weight=273.113}}
 

Revision as of 09:22, 27 August 2019

Metabolite Sulfhydryls

  • common-name:
    • r'c(r)sh

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality