Difference between revisions of "PWY-6121"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * common-name: ** coumarinate * smiles: ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-]...")
(Created page with "Category:pathway == Pathway PWY-6121 == * taxonomic-range: ** tax-2 ** tax-2759 * common-name: ** 5-aminoimidazole ribonucleotide biosynthesis i == Reaction(s) found == *...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] ==
+
== Pathway PWY-6121 ==
 +
* taxonomic-range:
 +
** tax-2
 +
** tax-2759
 
* common-name:
 
* common-name:
** coumarinate
+
** 5-aminoimidazole ribonucleotide biosynthesis i
* smiles:
+
== Reaction(s) found ==
** c(c=cc1(=c(c=cc=c1)o))(=o)[o-]
+
* [[AIRS-RXN]]
* inchi-key:
+
* [[FGAMSYN-RXN]]
** pmowtihvnwzyfi-waywqwqtsa-m
+
* [[GART-RXN]]
* molecular-weight:
+
* [[GLYRIBONUCSYN-RXN]]
** 163.152
+
* [[PRPPAMIDOTRANS-RXN]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
All reactions of this pathways are in present
* [[RXN-8036]]
+
{{#set: taxonomic-range=tax-2|tax-2759}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=5-aminoimidazole ribonucleotide biosynthesis i}}
{{#set: common-name=coumarinate}}
+
{{#set: nb reaction found=5}}
{{#set: inchi-key=inchikey=pmowtihvnwzyfi-waywqwqtsa-m}}
+
{{#set: completion rate=1.0}}
{{#set: molecular-weight=163.152}}
+
{{#set: nb total reaction=5}}

Revision as of 20:16, 18 December 2020

Pathway PWY-6121

  • taxonomic-range:
    • tax-2
    • tax-2759
  • common-name:
    • 5-aminoimidazole ribonucleotide biosynthesis i

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present