Difference between revisions of "PWY-6122"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Negatively-super-coiled-DNAs Negatively-super-coiled-DNAs] == * common-name: ** a negatively su...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Negatively-super-coiled-DNAs Negatively-super-coiled-DNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] ==
 
* common-name:
 
* common-name:
** a negatively supercoiled dna
+
** l-aspartate
 +
* smiles:
 +
** c(c(=o)[o-])c([n+])c(=o)[o-]
 +
* inchi-key:
 +
** ckljmwtzizzhcs-reohclbhsa-m
 +
* molecular-weight:
 +
** 132.096
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[5.99.1.2-RXN]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
* [[5.99.1.3-RXN]]
+
* [[ARGSUCCINSYN-RXN]]
 +
* [[ASNSYNA-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ASPCARBTRANS-RXN]]
 +
* [[L-ASPARTATE-OXID-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
 +
* [[RXN-10]]
 +
* [[RXN-13697]]
 +
* [[RXN-9772]]
 +
* [[SAICARSYN-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[5.99.1.2-RXN]]
+
* [[3.4.11.21-RXN]]
* [[5.99.1.3-RXN]]
+
* [[3.5.1.26-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[ASPARAGHYD-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ASPCARBTRANS-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN0-6975]]
 +
* [[RXN0-6987]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a negatively supercoiled dna}}
+
{{#set: common-name=l-aspartate}}
 +
{{#set: inchi-key=inchikey=ckljmwtzizzhcs-reohclbhsa-m}}
 +
{{#set: molecular-weight=132.096}}

Revision as of 09:23, 27 August 2019