Difference between revisions of "PWY-6122"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)...")
(Created page with "Category:pathway == Pathway PWY-5329 == * taxonomic-range: ** tax-40674 * common-name: ** l-cysteine degradation iii == Reaction(s) found == * CYSTEINE-AMINOTRANSFERASE-...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] ==
+
== Pathway PWY-5329 ==
 +
* taxonomic-range:
 +
** tax-40674
 
* common-name:
 
* common-name:
** l-aspartate
+
** l-cysteine degradation iii
* smiles:
+
== Reaction(s) found ==
** c(c(=o)[o-])c([n+])c(=o)[o-]
+
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
* inchi-key:
+
* [[MERCAPYSTRANS-RXN]]
** ckljmwtzizzhcs-reohclbhsa-m
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 132.096
+
{{#set: taxonomic-range=tax-40674}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=l-cysteine degradation iii}}
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
{{#set: nb reaction found=2}}
* [[ARGSUCCINSYN-RXN]]
+
{{#set: completion rate=1.0}}
* [[ASNSYNA-RXN]]
+
{{#set: nb total reaction=2}}
* [[ASNSYNB-RXN]]
 
* [[ASPAMINOTRANS-RXN]]
 
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 
* [[ASPARTATEKIN-RXN]]
 
* [[ASPCARBTRANS-RXN]]
 
* [[L-ASPARTATE-OXID-RXN]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
 
* [[RXN-10]]
 
* [[RXN-13697]]
 
* [[RXN-9772]]
 
* [[SAICARSYN-RXN]]
 
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
* [[3.4.11.21-RXN]]
 
* [[3.5.1.26-RXN]]
 
* [[ASPAMINOTRANS-RXN]]
 
* [[ASPARAGHYD-RXN]]
 
* [[ASPARTATEKIN-RXN]]
 
* [[ASPCARBTRANS-RXN]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[RXN-13697]]
 
* [[RXN0-6975]]
 
* [[RXN0-6987]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=l-aspartate}}
 
{{#set: inchi-key=inchikey=ckljmwtzizzhcs-reohclbhsa-m}}
 
{{#set: molecular-weight=132.096}}
 

Revision as of 20:19, 18 December 2020

Pathway PWY-5329

  • taxonomic-range:
    • tax-40674
  • common-name:
    • l-cysteine degradation iii

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present