Difference between revisions of "PWY-6122"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] ==
+== Pathway PWY-6122 ==
+* taxonomic-range:
+** tax-2157
+** tax-2
 * common-name:
-** icosatrienoyl-2-enoyl coa
+** 5-aminoimidazole ribonucleotide biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[AIRS-RXN]]
-* inchi-key:
+* [[FGAMSYN-RXN]]
-** yjkoikylhsmlhc-atrrwjjysa-j
+* [[GLYRIBONUCSYN-RXN]]
-* molecular-weight:
+* [[PRPPAMIDOTRANS-RXN]]
-** 1049.959
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneGARTRANSFORMYL2-RXN GARTRANSFORMYL2-RXN]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2|tax-2157}}
-* [[RXN-13001]]
+{{#set: common-name=5-aminoimidazole ribonucleotide biosynthesis ii}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=4}}
-{{#set: common-name=icosatrienoyl-2-enoyl coa}}
+{{#set: completion rate=0.8}}
-{{#set: inchi-key=inchikey=yjkoikylhsmlhc-atrrwjjysa-j}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=1049.959}}