Difference between revisions of "PWY-6122"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Negatively-super-coiled-DNAs Negatively-super-coiled-DNAs] ==
 * common-name:
-** icosatrienoyl-2-enoyl coa
+** a negatively supercoiled dna
-* smiles:
-** ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
-* inchi-key:
-** yjkoikylhsmlhc-atrrwjjysa-j
-* molecular-weight:
-** 1049.959
 == Reaction(s) known to consume the compound ==
+* [[5.99.1.2-RXN]]
+* [[5.99.1.3-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13001]]
+* [[5.99.1.2-RXN]]
+* [[5.99.1.3-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=icosatrienoyl-2-enoyl coa}}
+{{#set: common-name=a negatively supercoiled dna}}
-{{#set: inchi-key=inchikey=yjkoikylhsmlhc-atrrwjjysa-j}}
-{{#set: molecular-weight=1049.959}}