Difference between revisions of "PWY-6129"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2184 CPD0-2184] ==
+== Pathway PWY-5129 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
+** sphingolipid biosynthesis (plants)
-* smiles:
+== Reaction(s) found ==
-** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
+* [[3-DEHYDROSPHINGANINE-REDUCTASE-RXN]]
-* inchi-key:
+* [[RXN-7796]]
-** wcjyzufkktynlb-aritwgjrsa-l
+* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
-* molecular-weight:
+* [[SPHINGANINE-KINASE-RXN]]
-** 210.143
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN3O-1380 RXN3O-1380]
-* [[RXN-12070]]
+* [NoneRXN-11341 RXN-11341]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-7795 RXN-7795]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-7799 RXN-7799]
-{{#set: common-name=(2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}}
+* [NoneRXN-7792 RXN-7792]
-{{#set: inchi-key=inchikey=wcjyzufkktynlb-aritwgjrsa-l}}
+* [NoneRXN-7798 RXN-7798]
-{{#set: molecular-weight=210.143}}
+* [NoneRXN-14250 RXN-14250]
+* [NoneRXN-7801 RXN-7801]
+* [NoneRXN-7793 RXN-7793]
+{{#set: taxonomic-range=tax-33090}}
+{{#set: common-name=sphingolipid biosynthesis (plants)}}
+{{#set: nb reaction found=4}}
+{{#set: completion rate=0.31}}
+{{#set: nb total reaction=13}}