Difference between revisions of "PWY-6140"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] ==
+== Pathway PWY-6140 ==
+* taxonomic-range:
+** tax-2
+** tax-2759
 * common-name:
-** 2-methylbutanoyl-coa
+** cmp-2-keto-3-deoxy-d-glycero-d-galacto-nononate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[MANNKIN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** lynvnydeqmmnmz-xgxnyeovsa-j
+* [NoneRXN-9992 RXN-9992]
-* molecular-weight:
+* [NoneRXN-9993 RXN-9993]
-** 847.62
+* [NoneRXN-9991 RXN-9991]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2|tax-2759}}
-* [[2-MEBUCOA-FAD-RXN]]
+{{#set: common-name=cmp-2-keto-3-deoxy-d-glycero-d-galacto-nononate biosynthesis}}
-* [[2KETO-3METHYLVALERATE-RXN]]
+{{#set: nb reaction found=1}}
-* [[MBCOA-DHLIPOAMIDE-RXN]]
+{{#set: completion rate=0.25}}
-* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
+{{#set: nb total reaction=4}}
-== Reaction(s) known to produce the compound ==
-* [[2-MEBUCOA-FAD-RXN]]
-* [[2KETO-3METHYLVALERATE-RXN]]
-* [[DHRT_LPAREN_2mbcoa_RPAREN_]]
-* [[MBCOA-DHLIPOAMIDE-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=2-methylbutanoyl-coa}}
-{{#set: inchi-key=inchikey=lynvnydeqmmnmz-xgxnyeovsa-j}}
-{{#set: molecular-weight=847.62}}