Difference between revisions of "PWY-6146"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14717 CPD-14717] == * common-name: ** (r)-2-hydroxy-stearoyl-coa * smiles: ** ccccccccccccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRINOGEN PROTOPORPHYRINOGEN] == * common-name: ** protoporphyrinogen ix * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14717 CPD-14717] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRINOGEN PROTOPORPHYRINOGEN] ==
 
* common-name:
 
* common-name:
** (r)-2-hydroxy-stearoyl-coa
+
** protoporphyrinogen ix
 
* smiles:
 
* smiles:
** ccccccccccccccccc(o)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
 
* inchi-key:
 
* inchi-key:
** ojqmixcijflult-mxqbtarfsa-j
+
** uhsgpdmiqqynax-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 1045.968
+
** 566.699
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.]]
+
* [[PPPGO]]
* [[RXN66-475-CPD-14717//CPD-14719/FORMYL-COA.32.]]
+
* [[PROTOPORGENOXI-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.]]
+
* [[HEMN-RXN]]
 +
* [[RXN0-1461]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-2-hydroxy-stearoyl-coa}}
+
{{#set: common-name=protoporphyrinogen ix}}
{{#set: inchi-key=inchikey=ojqmixcijflult-mxqbtarfsa-j}}
+
{{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}}
{{#set: molecular-weight=1045.968}}
+
{{#set: molecular-weight=566.699}}

Revision as of 14:18, 26 August 2019

Metabolite PROTOPORPHYRINOGEN

  • common-name:
    • protoporphyrinogen ix
  • smiles:
    • c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
  • inchi-key:
    • uhsgpdmiqqynax-uhfffaoysa-l
  • molecular-weight:
    • 566.699

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality