Difference between revisions of "PWY-6147"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12575 CPD-12575] == * common-name: ** udp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o...")
(Created page with "Category:pathway == Pathway PWY-6147 == * taxonomic-range: ** tax-4751 ** tax-33090 ** tax-2 * common-name: ** 6-hydroxymethyl-dihydropterin diphosphate biosynthesis i ==...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12575 CPD-12575] ==
+
== Pathway PWY-6147 ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-33090
 +
** tax-2
 
* common-name:
 
* common-name:
** udp-α-d-glucose
+
** 6-hydroxymethyl-dihydropterin diphosphate biosynthesis i
* smiles:
+
== Reaction(s) found ==
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
+
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
* inchi-key:
+
* [[GTP-CYCLOHYDRO-I-RXN]]
** hscjrczfdfqwrp-jzmiexbbsa-l
+
* [[H2NEOPTERINALDOL-RXN]]
* molecular-weight:
+
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
** 564.289
+
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
All reactions of this pathways are in present
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
+
{{#set: taxonomic-range=tax-4751|tax-2|tax-33090}}
* [[2.4.1.117-RXN]]
+
{{#set: common-name=6-hydroxymethyl-dihydropterin diphosphate biosynthesis i}}
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
+
{{#set: nb reaction found=5}}
* [[GALACTURIDYLYLTRANS-RXN]]
+
{{#set: completion rate=1.0}}
* [[GLUC1PURIDYLTRANS-RXN]]
+
{{#set: nb total reaction=5}}
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
* [[RXN-12123]]
 
* [[RXN-12125]]
 
* [[RXN-12126]]
 
* [[RXN-12127]]
 
* [[RXN-12128]]
 
* [[RXN-1223]]
 
* [[RXN-15117]]
 
* [[RXN-16975]]
 
* [[RXN-4726]]
 
* [[RXN-4733]]
 
* [[RXN-5482]]
 
* [[RXN-7667]]
 
* [[RXN-7828]]
 
* [[RXN-8228]]
 
* [[RXN1F-461]]
 
* [[RXN1F-462]]
 
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
* [[TREHALOSE6PSYN-RXN]]
 
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UDPGth]]
 
* [[UG4E]]
 
* [[UG6PGT]]
 
* [[UG6PGTn]]
 
* [[UGD-RXN]]
 
* [[UGDH]]
 
</div>
 
== Reaction(s) known to produce the compound ==
 
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UDPGth]]
 
* [[UG1PUT]]
 
* [[UG4E]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=udp-&alpha;-d-glucose}}
 
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
 
{{#set: molecular-weight=564.289}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-6147

  • taxonomic-range:
    • tax-4751
    • tax-33090
    • tax-2
  • common-name:
    • 6-hydroxymethyl-dihydropterin diphosphate biosynthesis i

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present