Difference between revisions of "PWY-6147"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12575 CPD-12575] == * common-name: ** udp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-814-24-TRIENOL 44-DIMETHYL-CHOLESTA-814-24-TRIENOL] == * common-name: ** 4...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12575 CPD-12575] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-814-24-TRIENOL 44-DIMETHYL-CHOLESTA-814-24-TRIENOL] ==
 
* common-name:
 
* common-name:
−
** udp-α-d-glucose
+
** 4,4-dimethyl-cholesta-8,14,24-trienol
 
* smiles:
 
* smiles:
−
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
+
** cc(c)=cccc([ch]1(c2(c)(c(=cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
 
* inchi-key:
 
* inchi-key:
−
** hscjrczfdfqwrp-jzmiexbbsa-l
+
** lfqxezvyncbvdo-pbjlwwpksa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 564.289
+
** 410.682
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN66-306]]
−
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 
−
* [[2.4.1.117-RXN]]
 
−
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 
−
* [[GALACTURIDYLYLTRANS-RXN]]
 
−
* [[GLUC1PURIDYLTRANS-RXN]]
 
−
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 
−
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
−
* [[RXN-12123]]
 
−
* [[RXN-12125]]
 
−
* [[RXN-12126]]
 
−
* [[RXN-12127]]
 
−
* [[RXN-12128]]
 
−
* [[RXN-1223]]
 
−
* [[RXN-15117]]
 
−
* [[RXN-16975]]
 
−
* [[RXN-4726]]
 
−
* [[RXN-4733]]
 
−
* [[RXN-5482]]
 
−
* [[RXN-7667]]
 
−
* [[RXN-7828]]
 
−
* [[RXN-8228]]
 
−
* [[RXN1F-461]]
 
−
* [[RXN1F-462]]
 
−
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
−
* [[TREHALOSE6PSYN-RXN]]
 
−
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 
−
* [[UDPGLUCEPIM-RXN]]
 
−
* [[UDPGth]]
 
−
* [[UG4E]]
 
−
* [[UG6PGT]]
 
−
* [[UG6PGTn]]
 
−
* [[UGD-RXN]]
 
−
* [[UGDH]]
 
−
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[RXN3O-130]]
−
* [[GLUC1PURIDYLTRANS-RXN]]
+
* [[RXN66-305]]
−
* [[UDPGLUCEPIM-RXN]]
 
−
* [[UDPGth]]
 
−
* [[UG1PUT]]
 
−
* [[UG4E]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=udp-&alpha;-d-glucose}}
+
{{#set: common-name=4,4-dimethyl-cholesta-8,14,24-trienol}}
−
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
+
{{#set: inchi-key=inchikey=lfqxezvyncbvdo-pbjlwwpksa-n}}
−
{{#set: molecular-weight=564.289}}
+
{{#set: molecular-weight=410.682}}

Revision as of 09:22, 27 August 2019

Metabolite 44-DIMETHYL-CHOLESTA-814-24-TRIENOL

  • common-name:
    • 4,4-dimethyl-cholesta-8,14,24-trienol
  • smiles:
    • cc(c)=cccc([ch]1(c2(c)(c(=cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
  • inchi-key:
    • lfqxezvyncbvdo-pbjlwwpksa-n
  • molecular-weight:
    • 410.682

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PWY-6147&oldid=26766"