Difference between revisions of "PWY-6148"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] ==
+== Pathway PWY-6148 ==
+* taxonomic-range:
+** tax-578822
+** tax-224756
+** tax-183925
+** tax-183939
 * common-name:
-** 15,9'-di-cis-phytofluene
+** tetrahydromethanopterin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
+* [[H2NEOPTERINALDOL-RXN]]
-* inchi-key:
+* [[RXN-15733]]
-** ovsvtcfnlsgamm-iqemyqfosa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-10013 RXN-10013]
-** 542.93
+* [NoneRXN-15734 RXN-15734]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-10014 RXN-10014]
-* [[RXN-12244]]
+* [NoneRXN-8124 RXN-8124]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-10010 RXN-10010]
-* [[RXN-12243]]
+* [NoneRXN-10011 RXN-10011]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-10012 RXN-10012]
-{{#set: common-name=15,9'-di-cis-phytofluene}}
+* [NoneRXN-15555 RXN-15555]
-{{#set: inchi-key=inchikey=ovsvtcfnlsgamm-iqemyqfosa-n}}
+* [NoneCHORPYRLY-RXN CHORPYRLY-RXN]
-{{#set: molecular-weight=542.93}}
+* [NoneRXN-15741 RXN-15741]
+* [NoneRXN-15742 RXN-15742]
+* [NoneRXN-15732 RXN-15732]
+{{#set: taxonomic-range=tax-224756|tax-578822|tax-183939|tax-183925}}
+{{#set: common-name=tetrahydromethanopterin biosynthesis}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.14}}
+{{#set: nb total reaction=14}}