Difference between revisions of "PWY-6160"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] == * common-name: ** 15,9'-di-cis-phytofluene * smiles: ** cc(=cccc(=cccc(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phenols Phenols] == * common-name: ** a phenol == Reaction(s) known to consume the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phenols Phenols] ==
 
* common-name:
 
* common-name:
** 15,9'-di-cis-phytofluene
+
** a phenol
* smiles:
 
** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** ovsvtcfnlsgamm-iqemyqfosa-n
 
* molecular-weight:
 
** 542.93
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12244]]
+
* [[ARYL-SULFOTRANSFERASE-RXN]]
 +
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12243]]
+
* [[ARYLDIALKYLPHOSPHATASE-RXN]]
 +
* [[ARYLESTERASE-RXN]]
 +
* [[ARYLSULFAT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=15,9'-di-cis-phytofluene}}
+
{{#set: common-name=a phenol}}
{{#set: inchi-key=inchikey=ovsvtcfnlsgamm-iqemyqfosa-n}}
 
{{#set: molecular-weight=542.93}}
 

Revision as of 14:19, 26 August 2019