Difference between revisions of "PWY-6163"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * common-name: ** 3-oxo-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-N-omega-methyl-arginine Protein-N-omega-methyl-arginine] == * common-name: ** [protein]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-N-omega-methyl-arginine Protein-N-omega-methyl-arginine] ==
 
* common-name:
 
* common-name:
** 3-oxo-(9z)-octadecenoyl-coa
+
** [protein]-nω-methyl-l-arginine
* smiles:
 
** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** aveyykdekgjvbu-bpmmelmssa-j
 
* molecular-weight:
 
** 1041.936
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17778]]
+
* [[RXN-16891]]
 +
* [[RXN-16892]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17777]]
+
* [[RXN-16889]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(9z)-octadecenoyl-coa}}
+
{{#set: common-name=[protein]-nω-methyl-l-arginine}}
{{#set: inchi-key=inchikey=aveyykdekgjvbu-bpmmelmssa-j}}
 
{{#set: molecular-weight=1041.936}}
 

Revision as of 09:22, 27 August 2019

Metabolite Protein-N-omega-methyl-arginine

  • common-name:
    • [protein]-nω-methyl-l-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "protein]-nω-methyl-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.