Difference between revisions of "PWY-6168"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] ==
+== Pathway PWY-6168 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** leukotriene-d4
+** flavin biosynthesis iii (fungi)
-* smiles:
+== Reaction(s) found ==
-** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o
+* [[DIOHBUTANONEPSYN-RXN]]
-* inchi-key:
+* [[FADSYN-RXN]]
-** yeeskjgwjfyook-ijhyuljssa-m
+* [[GTP-CYCLOHYDRO-II-RXN]]
-* molecular-weight:
+* [[LUMAZINESYN-RXN]]
-** 495.653
+* [[RIBOFLAVIN-SYN-RXN]]
-== Reaction(s) known to consume the compound ==
+* [[RIBOFLAVINKIN-RXN]]
-== Reaction(s) known to produce the compound ==
+* [[RXN-10057]]
-* [[RXN66-336]]
+== Reaction(s) not found ==
-== Reaction(s) of unknown directionality ==
+* [NoneRIBOPHOSPHAT-RXN RIBOPHOSPHAT-RXN]
-{{#set: common-name=leukotriene-d4}}
+* [NoneRXN-10058 RXN-10058]
-{{#set: inchi-key=inchikey=yeeskjgwjfyook-ijhyuljssa-m}}
+{{#set: taxonomic-range=tax-4751}}
-{{#set: molecular-weight=495.653}}
+{{#set: common-name=flavin biosynthesis iii (fungi)}}
+{{#set: nb reaction found=7}}
+{{#set: completion rate=0.78}}
+{{#set: nb total reaction=9}}