Difference between revisions of "PWY-6168"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * common-name: ** leukotriene-d4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] == * common-name: ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dowccbnjuzolrj-mlagypmbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 396.612 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14917]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14929]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dowccbnjuzolrj-mlagypmbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=396.612}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-11712
- common-name:
- 2-methyl-6-geranylgeranyl-1,4-benzoquinol
- smiles:
- cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))c)c
- inchi-key:
- dowccbnjuzolrj-mlagypmbsa-n
- molecular-weight:
- 396.612
