Difference between revisions of "PWY-6168"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] == * common-name: ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol * smiles: *...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate LysW-L-glutamate] == * common-name: ** a [2-aminoadipate carrier protein]-l-gl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate LysW-L-glutamate] ==
 
* common-name:
 
* common-name:
** 2-methyl-6-geranylgeranyl-1,4-benzoquinol
+
** a [2-aminoadipate carrier protein]-l-glutamate
* smiles:
 
** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))c)c
 
* inchi-key:
 
** dowccbnjuzolrj-mlagypmbsa-n
 
* molecular-weight:
 
** 396.612
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14917]]
+
* [[RXN-15005]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14929]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}}
+
{{#set: common-name=a [2-aminoadipate carrier protein]-l-glutamate}}
{{#set: inchi-key=inchikey=dowccbnjuzolrj-mlagypmbsa-n}}
 
{{#set: molecular-weight=396.612}}
 

Revision as of 09:22, 27 August 2019

Metabolite LysW-L-glutamate

  • common-name:
    • a [2-aminoadipate carrier protein]-l-glutamate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [2-aminoadipate carrier protein]-l-glutamate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.