Difference between revisions of "PWY-621"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] ==
+== Pathway PWY-621 ==
+* taxonomic-range:
+** tax-2157
+** tax-2
+** tax-2759
 * common-name:
-** 2-methyl-6-geranylgeranyl-1,4-benzoquinol
+** sucrose degradation iii (sucrose invertase)
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))c)c
+* [[FRUCTOKINASE-RXN]]
-* inchi-key:
+* [[GLUCOKIN-RXN]]
-** dowccbnjuzolrj-mlagypmbsa-n
+* [[PGLUCISOM-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 396.612
+* [None3.2.1.48-RXN 3.2.1.48-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-* [[RXN-14917]]
+{{#set: common-name=sucrose degradation iii (sucrose invertase)}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=3}}
-* [[RXN-14929]]
+{{#set: completion rate=0.75}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}}
-{{#set: inchi-key=inchikey=dowccbnjuzolrj-mlagypmbsa-n}}
-{{#set: molecular-weight=396.612}}