Difference between revisions of "PWY-621"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] ==
+== Pathway PWY-7948 ==
+* taxonomic-range:
+** tax-33208
+** tax-2
 * common-name:
-** 2-methyl-6-geranylgeranyl-1,4-benzoquinol
+** levulinate degradation
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))c)c
+* [[RXN-12560]]
-* inchi-key:
+* [[RXN-12561]]
-** dowccbnjuzolrj-mlagypmbsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-19186 RXN-19186]
-** 396.612
+* [NoneRXN-19187 RXN-19187]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-19189 RXN-19189]
-* [[RXN-14917]]
+* [NoneRXN-19188 RXN-19188]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-19190 RXN-19190]
-* [[RXN-14929]]
+* [NoneRXN-19192 RXN-19192]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-19185 RXN-19185]
-{{#set: common-name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}}
+{{#set: taxonomic-range=tax-2|tax-33208}}
-{{#set: inchi-key=inchikey=dowccbnjuzolrj-mlagypmbsa-n}}
+{{#set: common-name=levulinate degradation}}
-{{#set: molecular-weight=396.612}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.22}}
+{{#set: nb total reaction=9}}