Difference between revisions of "PWY-6273"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-782 CPD-782] == * common-name: ** 3,4-dihydroxyphenylacetate * smiles: ** c([o-])(=o)cc1(c=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FLAVANONES FLAVANONES] == * common-name: ** a flavanone == Reaction(s) known to consume the com...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-782 CPD-782] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FLAVANONES FLAVANONES] ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxyphenylacetate
+
** a flavanone
* smiles:
 
** c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
 
* inchi-key:
 
** cffzdzcdufsofz-uhfffaoysa-m
 
* molecular-weight:
 
** 167.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[CHALCONE-ISOMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN6666-5]]
+
* [[CHALCONE-ISOMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxyphenylacetate}}
+
{{#set: common-name=a flavanone}}
{{#set: inchi-key=inchikey=cffzdzcdufsofz-uhfffaoysa-m}}
 
{{#set: molecular-weight=167.141}}
 

Revision as of 14:18, 26 August 2019

Metabolite FLAVANONES

  • common-name:
    • a flavanone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality