Difference between revisions of "PWY-6307"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINYL-ETCETERA-MANNOSYL-R GLUCOSAMINYL-ETCETERA-MANNOSYL-R] == * common-name: ** (n-acet...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE] == * common-name: ** 5-ami...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE] == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole |
| + | * smiles: | ||
| + | ** c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2) | ||
| + | * inchi-key: | ||
| + | ** pdacukokvhbvhj-xvfcmesisa-m | ||
| + | * molecular-weight: | ||
| + | ** 294.18 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[AIRCARBOXY-RXN]] |
| + | * [[PYRIMSYN1-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[AIRCARBOXY-RXN]] |
| + | * [[AIRS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-amino-1-(5-phospho-β-d-ribosyl)imidazole}} |
| + | {{#set: inchi-key=inchikey=pdacukokvhbvhj-xvfcmesisa-m}} | ||
| + | {{#set: molecular-weight=294.18}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE
- common-name:
- 5-amino-1-(5-phospho-β-d-ribosyl)imidazole
- smiles:
- c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2)
- inchi-key:
- pdacukokvhbvhj-xvfcmesisa-m
- molecular-weight:
- 294.18
