Difference between revisions of "PWY-6308"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2474 CPD0-2474] == * common-name: ** (s)-nadphx * smiles: ** c5(n(c1(oc(c(c1o)o)cop(op(occ...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-CD-S-SP-Complex S-CD-S-SP-Complex] == * common-name: ** an s-sulfanyl-[cysteine desulfurase]-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2474 CPD0-2474] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-CD-S-SP-Complex S-CD-S-SP-Complex] ==
 
* common-name:
 
* common-name:
** (s)-nadphx
+
** an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex
* smiles:
 
** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
 
* inchi-key:
 
** szkxtjuokargiy-vphrtnkssa-j
 
* molecular-weight:
 
** 759.41
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13139]]
+
* [[RXN-14386]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13139]]
+
* [[RXN-14385]]
* [[RXN-13142]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-nadphx}}
+
{{#set: common-name=an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex}}
{{#set: inchi-key=inchikey=szkxtjuokargiy-vphrtnkssa-j}}
 
{{#set: molecular-weight=759.41}}
 

Revision as of 09:22, 27 August 2019

Metabolite S-CD-S-SP-Complex

  • common-name:
    • an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.