Difference between revisions of "PWY-6308"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-with-5-taurinomethyl-2-thiouridine tRNA-with-5-taurinomethyl-2-thiouridine] == * common-na...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2474 CPD0-2474] == * common-name: ** (s)-nadphx * smiles: ** c5(n(c1(oc(c(c1o)o)cop(op(occ...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-with-5-taurinomethyl-2-thiouridine tRNA-with-5-taurinomethyl-2-thiouridine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2474 CPD0-2474] ==
 
* common-name:
 
* common-name:
** a 5-taurinomethyl-2-thiouridine in trna
+
** (s)-nadphx
 +
* smiles:
 +
** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
 +
* inchi-key:
 +
** szkxtjuokargiy-vphrtnkssa-j
 +
* molecular-weight:
 +
** 759.41
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13139]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16821]]
+
* [[RXN-13139]]
 +
* [[RXN-13142]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5-taurinomethyl-2-thiouridine in trna}}
+
{{#set: common-name=(s)-nadphx}}
 +
{{#set: inchi-key=inchikey=szkxtjuokargiy-vphrtnkssa-j}}
 +
{{#set: molecular-weight=759.41}}

Revision as of 14:19, 26 August 2019

Metabolite CPD0-2474

  • common-name:
    • (s)-nadphx
  • smiles:
    • c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
  • inchi-key:
    • szkxtjuokargiy-vphrtnkssa-j
  • molecular-weight:
    • 759.41

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality