Difference between revisions of "PWY-6309"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] ==
+== Pathway PWY-5710 ==
+* taxonomic-range:
+** tax-4070
 * common-name:
-** violaxanthin
+** capsaicin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4)
+* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** szcbxwmuopqsox-wvjdlnglsa-n
+* [NoneRXN-8927 RXN-8927]
-* molecular-weight:
+* [NoneRXN-8925 RXN-8925]
-** 600.88
+* [None4.1.2.41-RXN 4.1.2.41-RXN]
-== Reaction(s) known to consume the compound ==
+* [None4.2.1.101-RXN 4.2.1.101-RXN]
-* [[RXN-13185]]
+* [NoneRXN-8926 RXN-8926]
-* [[RXN-7984]]
+{{#set: taxonomic-range=tax-4070}}
-* [[RXN1F-155]]
+{{#set: common-name=capsaicin biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-13185]]
+{{#set: completion rate=0.17}}
-* [[RXN-7979]]
+{{#set: nb total reaction=6}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=violaxanthin}}
-{{#set: inchi-key=inchikey=szcbxwmuopqsox-wvjdlnglsa-n}}
-{{#set: molecular-weight=600.88}}