Difference between revisions of "PWY-6313"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEUCOPELARGONIDIN-CMPD LEUCOPELARGONIDIN-CMPD] ==
+== Pathway PWY-6313 ==
+* taxonomic-range:
+** tax-33208
 * common-name:
-** (2r,3s,4s)-leucopelargonidin
+** serotonin degradation
-* smiles:
+== Reaction(s) found ==
-** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o)
+* [[RXN-10777]]
-* inchi-key:
+* [[RXN-10778]]
-** fsvmlwolzhgcqx-souvjxgzsa-n
+* [[RXN-10780]]
-* molecular-weight:
+* [[RXN-10781]]
-** 290.272
+* [[RXN-10782]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-10784]]
-== Reaction(s) known to produce the compound ==
+== Reaction(s) not found ==
-* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
+* [NoneRXN-10779 RXN-10779]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-33208}}
-{{#set: common-name=(2r,3s,4s)-leucopelargonidin}}
+{{#set: common-name=serotonin degradation}}
-{{#set: inchi-key=inchikey=fsvmlwolzhgcqx-souvjxgzsa-n}}
+{{#set: nb reaction found=6}}
-{{#set: molecular-weight=290.272}}
+{{#set: completion rate=0.86}}
+{{#set: nb total reaction=7}}