Difference between revisions of "PWY-6318"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate LysW-L-glutamate] == * common-name: ** a [2-aminoadipate carrier protein]-l-gl...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == * common-name: ** methyl parathion * smiles: ** cop(oc1(=cc=c(c=c1)[n+](=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == |
* common-name: | * common-name: | ||
| − | ** | + | ** methyl parathion |
| + | * smiles: | ||
| + | ** cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s | ||
| + | * inchi-key: | ||
| + | ** rlbiqvvomopohc-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 263.204 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8743]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=methyl parathion}} |
| + | {{#set: inchi-key=inchikey=rlbiqvvomopohc-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=263.204}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-8973
- common-name:
- methyl parathion
- smiles:
- cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s
- inchi-key:
- rlbiqvvomopohc-uhfffaoysa-n
- molecular-weight:
- 263.204
