Difference between revisions of "PWY-6318"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == * common-name: ** methyl parathion * smiles: ** cop(oc1(=cc=c(c=c1)[n+](=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12829 CPD-12829] == * common-name: ** plastoquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12829 CPD-12829] == |
* common-name: | * common-name: | ||
| − | ** | + | ** plastoquinol-9 |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(=c1o)c)c)o))c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ijbljlrewplepb-iqsnhbbhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 751.23 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-2762]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=plastoquinol-9}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ijbljlrewplepb-iqsnhbbhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=751.23}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-12829
- common-name:
- plastoquinol-9
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(=c1o)c)c)o))c)c)c
- inchi-key:
- ijbljlrewplepb-iqsnhbbhsa-n
- molecular-weight:
- 751.23
