Difference between revisions of "PWY-6318"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12829 CPD-12829] ==
+== Pathway PWY-7137 ==
+* taxonomic-range:
+** tax-3398
 * common-name:
-** plastoquinol-9
+** quercetin gentiotetraside biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(=c1o)c)c)o))c)c)c
+* [[RXN1F-462]]
-* inchi-key:
+== Reaction(s) not found ==
-** ijbljlrewplepb-iqsnhbbhsa-n
+* [NoneRXN-13797 RXN-13797]
-* molecular-weight:
+* [NoneRXN-13798 RXN-13798]
-** 751.23
+* [NoneRXN-13799 RXN-13799]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-3398}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=quercetin gentiotetraside biosynthesis}}
-* [[RXN-2762]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=plastoquinol-9}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=ijbljlrewplepb-iqsnhbbhsa-n}}
-{{#set: molecular-weight=751.23}}