Difference between revisions of "PWY-6342"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] ==
+== Pathway PWY-6342 ==
+* taxonomic-range:
+** tax-7742
 * common-name:
-** (r)-3-hydroxyoctanoyl-coa
+** noradrenaline and adrenaline degradation
-* smiles:
+== Reaction(s) found ==
-** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
+* [[RXN-10907]]
-* inchi-key:
+* [[RXN-10908]]
-** atvgtmkwkducms-jwbywsjjsa-j
+* [[RXN-10910]]
-* molecular-weight:
+* [[RXN-10911]]
-** 905.7
+* [[RXN-10912]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-10913]]
-* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+* [[RXN-10915]]
-* [[RXN-14275]]
+* [[RXN-10917]]
-== Reaction(s) known to produce the compound ==
+== Reaction(s) not found ==
-* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+* [NoneRXN-10906 RXN-10906]
-* [[RXN-14276]]
+* [NoneRXN-10916 RXN-10916]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-10909 RXN-10909]
-{{#set: common-name=(r)-3-hydroxyoctanoyl-coa}}
+* [NoneRXN-10914 RXN-10914]
-{{#set: inchi-key=inchikey=atvgtmkwkducms-jwbywsjjsa-j}}
+* [NoneRXN66-241 RXN66-241]
-{{#set: molecular-weight=905.7}}
+{{#set: taxonomic-range=tax-7742}}
+{{#set: common-name=noradrenaline and adrenaline degradation}}
+{{#set: nb reaction found=8}}
+{{#set: completion rate=0.62}}
+{{#set: nb total reaction=13}}