Difference between revisions of "PWY-6343"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18532 CPD-18532] == * common-name: ** (r)-β-hydroxy-l-kynurenine * smiles: ** c([o-])(...")
 
(Created page with "Category:pathway == Pathway PWY-6343 == * taxonomic-range: ** tax-2 * common-name: ** ferulate degradation == Reaction(s) found == * 6.2.1.34-RXN == Reaction(s) not fo...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18532 CPD-18532] ==
+
== Pathway PWY-6343 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** (r)-β-hydroxy-l-kynurenine
+
** ferulate degradation
* smiles:
+
== Reaction(s) found ==
** c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1)
+
* [[6.2.1.34-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** memllrtvgbiljw-ionnqarksa-n
+
* [None4.1.2.41-RXN 4.1.2.41-RXN]
* molecular-weight:
+
* [None4.2.1.101-RXN 4.2.1.101-RXN]
** 224.216
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=ferulate degradation}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-17150]]
+
{{#set: completion rate=0.33}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=(r)-β-hydroxy-l-kynurenine}}
 
{{#set: inchi-key=inchikey=memllrtvgbiljw-ionnqarksa-n}}
 
{{#set: molecular-weight=224.216}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-6343

  • taxonomic-range:
    • tax-2
  • common-name:
    • ferulate degradation

Reaction(s) found

Reaction(s) not found

  • [None4.1.2.41-RXN 4.1.2.41-RXN]
  • [None4.2.1.101-RXN 4.2.1.101-RXN]