Difference between revisions of "PWY-6348"

Revision as of 09:22, 27 August 2019

common-name:
- a glycopeptide-d-mannosyl-n4-(n-acetyl-d-glucosaminyl)2-asparagine

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYLGERANYL-PP GERANYLGERANYL-PP] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=a-glycopeptide-D-mannosyl-Nsup4sup-N-ace a-glycopeptide-D-mannosyl-Nsup4sup-N-ace] ==
 * common-name:
-** geranylgeranyl diphosphate
+** a glycopeptide-d-mannosyl-n4-(n-acetyl-d-glucosaminyl)2-asparagine
-* smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
-* inchi-key:
-** oinneunvozhbox-qircyjposa-k
-* molecular-weight:
-** 447.424
 == Reaction(s) known to consume the compound ==
-* [[2.5.1.32-RXN]]
+* [[3.2.1.96-RXN]]
-* [[2.5.1.41-RXN]]
-* [[2.5.1.42-RXN]]
-* [[RXN-10625]]
-* [[RXN-11486]]
-* [[RXN-11488]]
-* [[RXN-13323]]
-* [[RXN-14929]]
-* [[RXN-17480]]
-* [[RXN-3701]]
-* [[RXN-7658]]
-* [[RXN-7663]]
-* [[RXN-7673]]
-* [[RXN-8788]]
 == Reaction(s) known to produce the compound ==
-* [[FARNESYLTRANSTRANSFERASE-RXN]]
-* [[GGPS]]
-* [[RXN-3701]]
-* [[RXN-7658]]
-* [[RXN-7673]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=geranylgeranyl diphosphate}}
+{{#set: common-name=a glycopeptide-d-mannosyl-n4-(n-acetyl-d-glucosaminyl)2-asparagine}}
-{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
-{{#set: molecular-weight=447.424}}