Difference between revisions of "PWY-6362"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE] == * common-name: ** cis...")
(Created page with "Category:pathway == Pathway PWY-6362 == * taxonomic-range: ** tax-33208 * common-name: ** 1d-myo-inositol hexakisphosphate biosynthesis ii (mammalian) == Reaction(s) found...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE] ==
+
== Pathway PWY-6362 ==
 +
* taxonomic-range:
 +
** tax-33208
 
* common-name:
 
* common-name:
** cis-dienelactone
+
** 1d-myo-inositol hexakisphosphate biosynthesis ii (mammalian)
* smiles:
+
== Reaction(s) found ==
** c1(=cc(=o)oc(=cc(=o)[o-])1)
+
* [[2.7.1.127-RXN]]
* inchi-key:
+
* [[2.7.1.133-RXN]]
** ayfxpgxazmfwnh-arjawskdsa-m
+
* [[2.7.1.140-RXN]]
* molecular-weight:
+
* [[RXN-7163]]
** 139.087
+
* [[RXN-8730]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
+
All reactions of this pathways are in present
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-33208}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=1d-myo-inositol hexakisphosphate biosynthesis ii (mammalian)}}
{{#set: common-name=cis-dienelactone}}
+
{{#set: nb reaction found=5}}
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-arjawskdsa-m}}
+
{{#set: completion rate=1.0}}
{{#set: molecular-weight=139.087}}
+
{{#set: nb total reaction=5}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-6362

  • taxonomic-range:
    • tax-33208
  • common-name:
    • 1d-myo-inositol hexakisphosphate biosynthesis ii (mammalian)

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present