Difference between revisions of "PWY-6362"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE] == * common-name: ** cis...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Deoxyhypusine-Synthase-Lysine Deoxyhypusine-Synthase-Lysine] == * common-name: ** a [deoxyhypus...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Deoxyhypusine-Synthase-Lysine Deoxyhypusine-Synthase-Lysine] ==
 
* common-name:
 
* common-name:
** cis-dienelactone
+
** a [deoxyhypusine synthase]-l-lysine
* smiles:
 
** c1(=cc(=o)oc(=cc(=o)[o-])1)
 
* inchi-key:
 
** ayfxpgxazmfwnh-arjawskdsa-m
 
* molecular-weight:
 
** 139.087
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
+
* [[RXN-13415]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13416]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-dienelactone}}
+
{{#set: common-name=a [deoxyhypusine synthase]-l-lysine}}
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-arjawskdsa-m}}
 
{{#set: molecular-weight=139.087}}
 

Revision as of 09:22, 27 August 2019

Metabolite Deoxyhypusine-Synthase-Lysine

  • common-name:
    • a [deoxyhypusine synthase]-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [deoxyhypusine synthase]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.