Difference between revisions of "PWY-6364"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15280 CPD-15280] == * common-name: ** hercynine * smiles: ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o...")
(Created page with "Category:pathway == Pathway PWY-6364 == * taxonomic-range: ** tax-2759 * common-name: ** d-myo-inositol (1,3,4)-trisphosphate biosynthesis == Reaction(s) found == * 2.7....")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15280 CPD-15280] ==
+
== Pathway PWY-6364 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** hercynine
+
** d-myo-inositol (1,3,4)-trisphosphate biosynthesis
* smiles:
+
== Reaction(s) found ==
** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-]
+
* [[2.7.1.127-RXN]]
* inchi-key:
+
* [[RXN-8730]]
** gppytcrvkhuljh-qmmmgpobsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [None3.1.3.62-RXN 3.1.3.62-RXN]
** 197.236
+
{{#set: taxonomic-range=tax-2759}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate biosynthesis}}
* [[RXN-14430]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.67}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=hercynine}}
 
{{#set: inchi-key=inchikey=gppytcrvkhuljh-qmmmgpobsa-n}}
 
{{#set: molecular-weight=197.236}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-6364

  • taxonomic-range:
    • tax-2759
  • common-name:
    • d-myo-inositol (1,3,4)-trisphosphate biosynthesis

Reaction(s) found

Reaction(s) not found

  • [None3.1.3.62-RXN 3.1.3.62-RXN]