Difference between revisions of "PWY-6368"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] ==
+== Pathway PWY-6368 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** 2,3-dihydroxybenzoate
+** 3-phosphoinositide degradation
-* smiles:
+== Reaction(s) found ==
-** c(c1(=cc=cc(=c1o)o))([o-])=o
+* [[3.1.3.66-RXN]]
-* inchi-key:
+* [[3.1.3.67-RXN]]
-** gldqamycgoijdv-uhfffaoysa-m
+* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
-* molecular-weight:
+* [[PHOSPHATIDYLINOSITOL-BISPHOSPHATASE-RXN]]
-** 153.114
+* [[RXN-10036]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-10947]]
-== Reaction(s) known to produce the compound ==
+== Reaction(s) not found ==
-* [[DHBDEHYD-RXN]]
+* [NoneRXN-10962 RXN-10962]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-9779 RXN-9779]
-{{#set: common-name=2,3-dihydroxybenzoate}}
+* [NoneRXN-10961 RXN-10961]
-{{#set: inchi-key=inchikey=gldqamycgoijdv-uhfffaoysa-m}}
+{{#set: taxonomic-range=tax-2759}}
-{{#set: molecular-weight=153.114}}
+{{#set: common-name=3-phosphoinositide degradation}}
+{{#set: nb reaction found=6}}
+{{#set: completion rate=0.67}}
+{{#set: nb total reaction=9}}