Difference between revisions of "PWY-6368"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] == * common-name: ** 2,3-dihydroxybenzoate * smile...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18309 CPD-18309] == * common-name: ** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18309 CPD-18309] == |
* common-name: | * common-name: | ||
− | ** 2,3- | + | ** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(c)c(c([o-])=o)nc(=o)c([n+])cnc(=o)c1(oc(c(=o)n)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hcgfosjnuodeoh-rulnzfcnsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 316.313 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16991]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=2,3- | + | {{#set: common-name=n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hcgfosjnuodeoh-rulnzfcnsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=316.313}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-18309
- common-name:
- n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine
- smiles:
- cc(c)c(c([o-])=o)nc(=o)c([n+])cnc(=o)c1(oc(c(=o)n)1)
- inchi-key:
- hcgfosjnuodeoh-rulnzfcnsa-n
- molecular-weight:
- 316.313