Difference between revisions of "PWY-6369"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] == * common-name: ** 5-(methylthio)ribulose 1-phosphate * smiles: ** cscc(o)...")
(Created page with "Category:pathway == Pathway PWY-6369 == * taxonomic-range: ** tax-2759 * common-name: ** inositol pyrophosphates biosynthesis == Reaction(s) found == * 2.7.1.152-RXN *...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] ==
+
== Pathway PWY-6369 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** 5-(methylthio)ribulose 1-phosphate
+
** inositol pyrophosphates biosynthesis
* smiles:
+
== Reaction(s) found ==
** cscc(o)c(o)c(=o)cop([o-])(=o)[o-]
+
* [[2.7.1.152-RXN]]
* inchi-key:
+
* [[2.7.4.24-RXN]]
** cnsjryumvmwnmc-ritpcoansa-l
+
* [[RXN-10971]]
* molecular-weight:
+
* [[RXN-10972]]
** 258.182
+
* [[RXN-10973]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-10974]]
* [[R145-RXN]]
+
* [[RXN-10979]]
== Reaction(s) known to produce the compound ==
+
* [[RXN-7163]]
* [[5.3.1.23-RXN]]
+
== Reaction(s) not found ==
* [[M5TRPI]]
+
* [NoneRXN-4941 RXN-4941]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-2759}}
{{#set: common-name=5-(methylthio)ribulose 1-phosphate}}
+
{{#set: common-name=inositol pyrophosphates biosynthesis}}
{{#set: inchi-key=inchikey=cnsjryumvmwnmc-ritpcoansa-l}}
+
{{#set: nb reaction found=8}}
{{#set: molecular-weight=258.182}}
+
{{#set: completion rate=0.89}}
 +
{{#set: nb total reaction=9}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-6369

  • taxonomic-range:
    • tax-2759
  • common-name:
    • inositol pyrophosphates biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-4941 RXN-4941]