Difference between revisions of "PWY-6369"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] ==
+== Pathway PWY-6369 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** 1-chloro-2,4-dinitrobenzene
+** inositol pyrophosphates biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o)
+* [[2.7.1.152-RXN]]
-* inchi-key:
+* [[2.7.4.24-RXN]]
-** vyzahlcbvhpddf-uhfffaoysa-n
+* [[RXN-10971]]
-* molecular-weight:
+* [[RXN-10972]]
-** 202.554
+* [[RXN-10973]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-10974]]
-* [[GST-RXN]]
+* [[RXN-10979]]
-== Reaction(s) known to produce the compound ==
+* [[RXN-7163]]
-* [[GST-RXN]]
+== Reaction(s) not found ==
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-4941 RXN-4941]
-{{#set: common-name=1-chloro-2,4-dinitrobenzene}}
+{{#set: taxonomic-range=tax-2759}}
-{{#set: inchi-key=inchikey=vyzahlcbvhpddf-uhfffaoysa-n}}
+{{#set: common-name=inositol pyrophosphates biosynthesis}}
-{{#set: molecular-weight=202.554}}
+{{#set: nb reaction found=8}}
+{{#set: completion rate=0.89}}
+{{#set: nb total reaction=9}}