Difference between revisions of "PWY-6369"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] ==
+== Pathway PWY-7942 ==
+* taxonomic-range:
+** tax-2759
+** tax-2
+** tax-2157
 * common-name:
-** 5-(methylthio)ribulose 1-phosphate
+** 5-oxo-l-proline metabolism
-* smiles:
+== Reaction(s) found ==
-** cscc(o)c(o)c(=o)cop([o-])(=o)[o-]
+* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** cnsjryumvmwnmc-ritpcoansa-l
+* [NoneRXN-19146 RXN-19146]
-* molecular-weight:
+* [NoneRXN-19145 RXN-19145]
-** 258.182
+* [NoneRXN-19022 RXN-19022]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-19024 RXN-19024]
-* [[R145-RXN]]
+* [NonePYROGLUTAMYL-PEPTIDASE-I-RXN PYROGLUTAMYL-PEPTIDASE-I-RXN]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-* [[5.3.1.23-RXN]]
+{{#set: common-name=5-oxo-l-proline metabolism}}
-* [[M5TRPI]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.17}}
-{{#set: common-name=5-(methylthio)ribulose 1-phosphate}}
+{{#set: nb total reaction=6}}
-{{#set: inchi-key=inchikey=cnsjryumvmwnmc-ritpcoansa-l}}
-{{#set: molecular-weight=258.182}}